CAS 937596-85-5 is the registry number for 5-Fluoro-2-(2-(thiophen-2-yl)ethoxy)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-fluoro-2-(2-thiophen-2-ylethoxy)aniline (CAS 937596-85-5) is a chemical compound with the molecular formula C12H12FNOS and a molecular weight of 237.30 g/mol. IUPAC name: 5-fluoro-2-(2-thiophen-2-ylethoxy)aniline. InChIKey: FFENFBDQPZNNGM-UHFFFAOYSA-N.
| Molecular formula | C12H12FNOS |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | 5-fluoro-2-(2-thiophen-2-ylethoxy)aniline |
| InChIKey | FFENFBDQPZNNGM-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CCOC2=C(C=C(C=C2)F)N |
Computed by PubChem (NCBI)