Products 71933-03-4
CAS 71933-03-4 is the registry number for Methyl 5-bromo-2-hydroxypyrimidine-4-carboxylate, 97%. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
Methyl 5-bromo-2-oxo-1H-pyrimidine-6-carboxylate (CAS 71933-03-4) is a chemical compound with the molecular formula C6H5BrN2O3 and a molecular weight of 233.02 g/mol. IUPAC name: methyl 5-bromo-2-oxo-1H-pyrimidine-6-carboxylate. InChIKey: LQTKGJRZBOYLEY-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O3 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | methyl 5-bromo-2-oxo-1H-pyrimidine-6-carboxylate |
| InChIKey | LQTKGJRZBOYLEY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=NC(=O)N1)Br |
Computed by PubChem (NCBI)