CAS 7199-29-3 appears in our catalog under these names: Cyheptamide, >95% (HPLC), CYHEPTAMIDE. Offered by: TRC, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 50mg, 5MG.
Tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carboxamide (CAS 7199-29-3) is a chemical compound with the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. IUPAC name: tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carboxamide. InChIKey: APBVLLORZMAWKI-UHFFFAOYSA-N.
| Molecular formula | C16H15NO |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carboxamide |
| InChIKey | APBVLLORZMAWKI-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C(C3=CC=CC=C31)C(=O)N |
Computed by PubChem (NCBI)