Products 72000-67-0
CAS 72000-67-0 appears in our catalog under these names: 3-Bromo-1-phenyl-1h-pyrrole-2,5-dione, 95%, 3-Bromo-1-phenyl-1H-pyrrole-2,5-dione, 97%, 97%, 3-bromo-1-phenyl-1H-pyrrole-2,5-dione, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg.
3-bromo-1-phenylpyrrole-2,5-dione (CAS 72000-67-0) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 3-bromo-1-phenylpyrrole-2,5-dione. InChIKey: XPWBLMOTTABVDZ-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 3-bromo-1-phenylpyrrole-2,5-dione |
| InChIKey | XPWBLMOTTABVDZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C=C(C2=O)Br |
Computed by PubChem (NCBI)
Synonyms:
3-bromo-1-phenyl-2,5-dihydro-1H-pyrrole-2,5-dione, 3-bromo-1-phenyl-1H-pyrrole-2,5-dione, 3-bromo-1-phenylpyrrole-2,5-dione, 3-Bromo-1-phenyl-pyrrole-2,5-dione, 1H-Pyrrole-2,5-dione, 3-bromo-1-phenyl-, 3-bromo-1-phenylazoline-2,5-dione, N-Phenylbromomaleimide, bromo N-phenyl maleimide, N-phenyl monobromomaleimide