CAS 7206-70-4 appears in our catalog under these names: 4-Amino-5-chloro-2-methoxybenzoic Acid, 4–Amino–5–chloro–2–methoxybenzoic acid, 4-AMINO-5-CHLORO-2-METHOXYBENZOIC ACID,, 4-Amino-5-chloro-2-methoxybenzoic acid (Standard), 4-Amino-5-chloro-2-methoxybenzoic acid, 95%. Offered by: Mikromol, GLPBio, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 25mg, 100mg, 100g, 25g, 250g, 500g, 1000g, 5G.
4-amino-5-chloro-2-methoxybenzoic acid (CAS 7206-70-4) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 4-amino-5-chloro-2-methoxybenzoic acid. InChIKey: RVEATKYEARPWRE-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 4-amino-5-chloro-2-methoxybenzoic acid |
| InChIKey | RVEATKYEARPWRE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)Cl)N |
Computed by PubChem (NCBI)