CAS 720674-30-6 is the registry number for 3-(3’,4’-Dimethoxyphenyl)-6-ethoxy-4-methylcoumarin, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,4-dimethoxyphenyl)-6-ethoxy-4-methylchromen-2-one (CAS 720674-30-6) is a chemical compound with the molecular formula C20H20O5 and a molecular weight of 340.4 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-6-ethoxy-4-methylchromen-2-one. InChIKey: YMSWWWYWXZINGY-UHFFFAOYSA-N.
| Molecular formula | C20H20O5 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-6-ethoxy-4-methylchromen-2-one |
| InChIKey | YMSWWWYWXZINGY-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)OC(=O)C(=C2C)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)