Products 84709-25-1
CAS 84709-25-1 appears in our catalog under these names: (–)–Zuonin A, (-)-Zuonin A, 98%, d-Epigalbacin/ 99.25% (existing batch purity), (-)-Zuonin A, 5,5′-[(2S,3R,4S,5S)-Tetrahydro-3,4-dimethyl-2,5-furandiyl]bis[1,3-benzodioxole], 95%, 95%. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 25mg, 50mg, 100mg, 5mg, 10mg, 200mg, 5 mg.
5-[(2S,3R,4S,5S)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole (CAS 84709-25-1) is a chemical compound with the molecular formula C20H20O5 and a molecular weight of 340.4 g/mol. IUPAC name: 5-[(2S,3R,4S,5S)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole. InChIKey: QFUXQRHAJWXPGP-YLYZPZNOSA-N.
| Molecular formula | C20H20O5 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 5-[(2S,3R,4S,5S)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-1,3-benzodioxole |
| InChIKey | QFUXQRHAJWXPGP-YLYZPZNOSA-N |
| SMILES | C[C@@H]1[C@@H]([C@H](O[C@@H]1C2=CC3=C(C=C2)OCO3)C4=CC5=C(C=C4)OCO5)C |
Computed by PubChem (NCBI)