CAS 720700-63-0 is the registry number for 9,9,10-Triphenyl-9,10-dihydroacridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
9,9,10-triphenylacridine (CAS 720700-63-0) is a chemical compound with the molecular formula C31H23N and a molecular weight of 409.5 g/mol. IUPAC name: 9,9,10-triphenylacridine. InChIKey: VSGWVEVRRCPUBK-UHFFFAOYSA-N.
| Molecular formula | C31H23N |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | 9,9,10-triphenylacridine |
| InChIKey | VSGWVEVRRCPUBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3N(C4=CC=CC=C42)C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)