CAS 851343-53-8 appears in our catalog under these names: N-Phenyl-4-(9-phenyl-9H-fluoren-9-yl)aniline, 95%, 95%, N-Phenyl-4-(9-phenyl-9H-fluoren-9-yl)aniline, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
N-phenyl-4-(9-phenylfluoren-9-yl)aniline (CAS 851343-53-8) is a chemical compound with the molecular formula C31H23N and a molecular weight of 409.5 g/mol. IUPAC name: N-phenyl-4-(9-phenylfluoren-9-yl)aniline. InChIKey: MXBOCMZLJOCPLE-UHFFFAOYSA-N.
| Molecular formula | C31H23N |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | N-phenyl-4-(9-phenylfluoren-9-yl)aniline |
| InChIKey | MXBOCMZLJOCPLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC=C(C=C5)NC6=CC=CC=C6 |
Computed by PubChem (NCBI)