CAS 721-90-4 appears in our catalog under these names: Phenylalanylglycine, >95% (HPLC), H–Phe–Gly–OH, L-PHENYLALANYLGLYCINE, 95%, 95%, Phe-Gly, 96.41%, Phe-Gly-OH, 96%. Offered by: TRC, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 500mg, 50mg, 25g, 5g, 250mg, 1g, 100 mg.
2-[(2-amino-3-phenylpropanoyl)amino]acetic acid (CAS 721-90-4) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: 2-[(2-amino-3-phenylpropanoyl)amino]acetic acid. InChIKey: GLUBLISJVJFHQS-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 2-[(2-amino-3-phenylpropanoyl)amino]acetic acid |
| InChIKey | GLUBLISJVJFHQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)NCC(=O)O)N |
Computed by PubChem (NCBI)