CAS 72107-05-2 appears in our catalog under these names: 2,2,4-Trimethyl-1,2-dihydroquinolin-6-ol, 95%, Ethoxyquin-desethyl, 2,2,4–Trimethyl–1,2–dihydroquinolin–6–ol, 2,2,4-Trimethyl-1,2-dihydroquinolin-6-ol 97%, 2,2,4-Trimethyl-1,2-dihydroquinolin-6-ol, 95%, 95%. Offered by: AmBeed, Dr. Ehrenstorfer, GLPBio, Chemat, HPC Standards. Available pack sizes: 25g, 50mg, 1g, 5g, 100mg, 250mg, 500mg, 10g.
2,2,4-trimethyl-1H-quinolin-6-ol (CAS 72107-05-2) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 2,2,4-trimethyl-1H-quinolin-6-ol. InChIKey: QSINDHMECZQCAW-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 2,2,4-trimethyl-1H-quinolin-6-ol |
| InChIKey | QSINDHMECZQCAW-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=C(C=C2)O)(C)C |
Computed by PubChem (NCBI)