Products 2140305-22-0
CAS 2140305-22-0 appears in our catalog under these names: 3-(2-Aminoethyl)-2-methyl-1H-indole-6-carboxylic acid hydrochloride, 95%, 3-(2-AMinoethyl)-2-methyl-1H-indole-6-carboxylic acid HCl, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
3-(2-aminoethyl)-2-methyl-1H-indole-6-carboxylic acid;hydrochloride (CAS 2140305-22-0) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 3-(2-aminoethyl)-2-methyl-1H-indole-6-carboxylic acid;hydrochloride. InChIKey: XIQVXJVPBPOGFW-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 3-(2-aminoethyl)-2-methyl-1H-indole-6-carboxylic acid;hydrochloride |
| InChIKey | XIQVXJVPBPOGFW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=C(C=C2)C(=O)O)CCN.Cl |
Computed by PubChem (NCBI)