Products 72224-27-2

CAS 72224-27-2 is the registry number for 4-(2-Oxiranylmethoxy)benzeneacetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[4-(oxiran-2-ylmethoxy)phenyl]acetate (CAS 72224-27-2) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: methyl 2-[4-(oxiran-2-ylmethoxy)phenyl]acetate. InChIKey: UGCLEKVSHFQKOD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O4
Molecular weight222.24 g/mol
IUPAC namemethyl 2-[4-(oxiran-2-ylmethoxy)phenyl]acetate
InChIKeyUGCLEKVSHFQKOD-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CC=C(C=C1)OCC2CO2

Computed by PubChem (NCBI)