Products 72301-78-1
CAS 72301-78-1 appears in our catalog under these names: Zinviroxime, >95% (HPLC), Zinviroxime. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
(NZ)-N-[(2-amino-3-propan-2-ylsulfonylbenzimidazol-5-yl)-phenylmethylidene]hydroxylamine (CAS 72301-78-1) is a chemical compound with the molecular formula C17H18N4O3S and a molecular weight of 358.4 g/mol. IUPAC name: (NZ)-N-[(2-amino-3-propan-2-ylsulfonylbenzimidazol-5-yl)-phenylmethylidene]hydroxylamine. InChIKey: IWKXBHQELWQLHF-SILNSSARSA-N.
| Molecular formula | C17H18N4O3S |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (NZ)-N-[(2-amino-3-propan-2-ylsulfonylbenzimidazol-5-yl)-phenylmethylidene]hydroxylamine |
| InChIKey | IWKXBHQELWQLHF-SILNSSARSA-N |
| SMILES | CC(C)S(=O)(=O)N1C2=C(C=CC(=C2)/C(=N\O)/C3=CC=CC=C3)N=C1N |
Computed by PubChem (NCBI)