CAS 72301-79-2 appears in our catalog under these names: Enviroxime, >95% (HPLC), Enviroxime, Enviroxime, 99.9%. Offered by: TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 1mg, 5mg, 1 mg, 5 mg.
(NE)-N-[(2-amino-3-propan-2-ylsulfonylbenzimidazol-5-yl)-phenylmethylidene]hydroxylamine (CAS 72301-79-2) is a chemical compound with the molecular formula C17H18N4O3S and a molecular weight of 358.4 g/mol. IUPAC name: (NE)-N-[(2-amino-3-propan-2-ylsulfonylbenzimidazol-5-yl)-phenylmethylidene]hydroxylamine. InChIKey: IWKXBHQELWQLHF-CAPFRKAQSA-N.
| Molecular formula | C17H18N4O3S |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (NE)-N-[(2-amino-3-propan-2-ylsulfonylbenzimidazol-5-yl)-phenylmethylidene]hydroxylamine |
| InChIKey | IWKXBHQELWQLHF-CAPFRKAQSA-N |
| SMILES | CC(C)S(=O)(=O)N1C2=C(C=CC(=C2)/C(=N/O)/C3=CC=CC=C3)N=C1N |
Computed by PubChem (NCBI)