Products 72358-14-6
CAS 72358-14-6 is the registry number for L-Kynurenine-5-F. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-amino-4-(2-amino-5-fluorophenyl)-4-oxobutanoic acid (CAS 72358-14-6) is a chemical compound with the molecular formula C10H11FN2O3 and a molecular weight of 226.20 g/mol. IUPAC name: (2S)-2-amino-4-(2-amino-5-fluorophenyl)-4-oxobutanoic acid. InChIKey: MWVFOEACBHXRGX-QMMMGPOBSA-N.
| Molecular formula | C10H11FN2O3 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | (2S)-2-amino-4-(2-amino-5-fluorophenyl)-4-oxobutanoic acid |
| InChIKey | MWVFOEACBHXRGX-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)C[C@@H](C(=O)O)N)N |
Computed by PubChem (NCBI)