CAS 72359-37-6 appears in our catalog under these names: 1-Benzylpyridin-4(1h)-one, 95%, 1-Benzylpyridin-4(1H)-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
1-benzylpyridin-4-one (CAS 72359-37-6) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: 1-benzylpyridin-4-one. InChIKey: BZBBXVLXVOZFRH-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 1-benzylpyridin-4-one |
| InChIKey | BZBBXVLXVOZFRH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC(=O)C=C2 |
Computed by PubChem (NCBI)