CAS 723738-42-9 is the registry number for (4-nitrophenyl)-N-(3-(phenylmethoxy)(2-pyridyl))formamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-nitro-N-(3-phenylmethoxy-2-pyridinyl)benzamide (CAS 723738-42-9) is a chemical compound with the molecular formula C19H15N3O4 and a molecular weight of 349.3 g/mol. IUPAC name: 4-nitro-N-(3-phenylmethoxy-2-pyridinyl)benzamide. InChIKey: LJMZUGXZJVFKMC-UHFFFAOYSA-N.
| Molecular formula | C19H15N3O4 |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | 4-nitro-N-(3-phenylmethoxy-2-pyridinyl)benzamide |
| InChIKey | LJMZUGXZJVFKMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CC=C2)NC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)