CAS 7244-78-2 appears in our catalog under these names: 1-Butoxy-4-nitrobenzene, 95%, 1–Butoxy–4–nitrobenzene, 1-Butoxy-4-nitrobenzene, >99.0%(GC), 1-Butoxy-4-nitrobenzene, 98%, 98%, 1-Butoxy-4-nitrobenzene, 98%. Offered by: AmBeed, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 100g.
1-butoxy-4-nitrobenzene (CAS 7244-78-2) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 1-butoxy-4-nitrobenzene. InChIKey: XCCDVVZINDJESR-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 1-butoxy-4-nitrobenzene |
| InChIKey | XCCDVVZINDJESR-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)