CAS 724771-61-3 appears in our catalog under these names: 4-(3-Fluoro-4-methoxyphenyl)dihydro-2H-pyran-2,6(3H)-dione, 95%, 4–(3–Fluoro–4–methoxyphenyl)dihydro–2H–pyran–2,6(3H)–dione. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 10mg.
4-(3-fluoro-4-methoxyphenyl)oxane-2,6-dione (CAS 724771-61-3) is a chemical compound with the molecular formula C12H11FO4 and a molecular weight of 238.21 g/mol. IUPAC name: 4-(3-fluoro-4-methoxyphenyl)oxane-2,6-dione. InChIKey: GLQYZXYTPGHPKA-UHFFFAOYSA-N.
| Molecular formula | C12H11FO4 |
|---|---|
| Molecular weight | 238.21 g/mol |
| IUPAC name | 4-(3-fluoro-4-methoxyphenyl)oxane-2,6-dione |
| InChIKey | GLQYZXYTPGHPKA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2CC(=O)OC(=O)C2)F |
Computed by PubChem (NCBI)