Products 676348-58-6
CAS 676348-58-6 is the registry number for 2-(4-Fluoro-benzoyl)-3-oxo-butyric acid methylester. Offered by: Fluorochem. Available pack sizes: 1g.
Methyl 2-(4-fluorobenzoyl)-3-oxobutanoate (CAS 676348-58-6) is a chemical compound with the molecular formula C12H11FO4 and a molecular weight of 238.21 g/mol. IUPAC name: methyl 2-(4-fluorobenzoyl)-3-oxobutanoate. InChIKey: FVSKWULORMNCHA-UHFFFAOYSA-N.
| Molecular formula | C12H11FO4 |
|---|---|
| Molecular weight | 238.21 g/mol |
| IUPAC name | methyl 2-(4-fluorobenzoyl)-3-oxobutanoate |
| InChIKey | FVSKWULORMNCHA-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(=O)C1=CC=C(C=C1)F)C(=O)OC |
Computed by PubChem (NCBI)