CAS 7251-82-3 is the registry number for 4-Methylisoindoline-1,3-dione, 97%. Offered by: AmBeed. Available pack sizes: 5g.
4-methylisoindole-1,3-dione (CAS 7251-82-3) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 4-methylisoindole-1,3-dione. InChIKey: ABCGRFHYOYXEJV-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 4-methylisoindole-1,3-dione |
| InChIKey | ABCGRFHYOYXEJV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)NC2=O |
Computed by PubChem (NCBI)