Products 7257-25-2
CAS 7257-25-2 is the registry number for 7,8,9,10-Tetrahydrocyclohepta[b]indol-6(5H)-one, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg.
7,8,9,10-tetrahydro-5H-cyclohepta[b]indol-6-one (CAS 7257-25-2) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 7,8,9,10-tetrahydro-5H-cyclohepta[b]indol-6-one. InChIKey: PHIOOOPODSRCSJ-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 7,8,9,10-tetrahydro-5H-cyclohepta[b]indol-6-one |
| InChIKey | PHIOOOPODSRCSJ-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C2=C(C1)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)