CAS 72570-70-8 appears in our catalog under these names: Bisoprolol Acid Impurity, Bisoprolol Impurity 18, 4-(2-Hydroxy-3-isopropylaminopropoxy)benzoic Acid, >95% (HPLC), Bisoprolol Carboxylic Acid Impurity. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
4-[2-hydroxy-3-(propan-2-ylamino)propoxy]benzoic acid (CAS 72570-70-8) is a chemical compound with the molecular formula C13H19NO4 and a molecular weight of 253.29 g/mol. IUPAC name: 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]benzoic acid. InChIKey: WONQRVASZHJNFS-UHFFFAOYSA-N.
| Molecular formula | C13H19NO4 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]benzoic acid |
| InChIKey | WONQRVASZHJNFS-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)C(=O)O)O |
Computed by PubChem (NCBI)