CAS 726153-94-2 is the registry number for Bis(4-methylphenyl)-1,3-oxazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4,5-bis(4-methylphenyl)-1,3-oxazol-2-amine (CAS 726153-94-2) is a chemical compound with the molecular formula C17H16N2O and a molecular weight of 264.32 g/mol. IUPAC name: 4,5-bis(4-methylphenyl)-1,3-oxazol-2-amine. InChIKey: BKFNWOIDUOMJEQ-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | 4,5-bis(4-methylphenyl)-1,3-oxazol-2-amine |
| InChIKey | BKFNWOIDUOMJEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(OC(=N2)N)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)