CAS 72635-67-7 appears in our catalog under these names: Regadenoson Impurity 26, Regadenoson Impurity 58. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S,4R,5S)-2-(6-amino-2-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 72635-67-7) is a chemical compound with the molecular formula C10H12ClN5O4 and a molecular weight of 301.69 g/mol. IUPAC name: (2S,3S,4R,5S)-2-(6-amino-2-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: BIXYYZIIJIXVFW-GIMIYPNGSA-N.
| Molecular formula | C10H12ClN5O4 |
|---|---|
| Molecular weight | 301.69 g/mol |
| IUPAC name | (2S,3S,4R,5S)-2-(6-amino-2-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | BIXYYZIIJIXVFW-GIMIYPNGSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1[C@@H]3[C@H]([C@H]([C@@H](O3)CO)O)O)Cl)N |
Computed by PubChem (NCBI)