Products 769872-68-6
CAS 769872-68-6 is the registry number for 8-Chloro-arabinoadenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,4S,5R)-2-(6-amino-8-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 769872-68-6) is a chemical compound with the molecular formula C10H12ClN5O4 and a molecular weight of 301.69 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(6-amino-8-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: MHDPPLULTMGBSI-FJFJXFQQSA-N.
| Molecular formula | C10H12ClN5O4 |
|---|---|
| Molecular weight | 301.69 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(6-amino-8-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | MHDPPLULTMGBSI-FJFJXFQQSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C(=N2)Cl)[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)O)N |
Computed by PubChem (NCBI)