CAS 72667-90-4 is the registry number for 2,5-Dimethoxy-alpha,alpha-dimethylbenzenemethanol. Offered by: TRC. Available pack sizes: 2,5g.
2-(2,5-dimethoxyphenyl)propan-2-ol (CAS 72667-90-4) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: 2-(2,5-dimethoxyphenyl)propan-2-ol. InChIKey: AOSORYLGACCTON-UHFFFAOYSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 2-(2,5-dimethoxyphenyl)propan-2-ol |
| InChIKey | AOSORYLGACCTON-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=CC(=C1)OC)OC)O |
Computed by PubChem (NCBI)