CAS 727-55-9 appears in our catalog under these names: Dimethyl 2,3,5,6-tetrafluoroterephthalate, 98%, Dimethyl 2,3,5,6–tetrafluoroterephthalate, Dimethyl 2,3,5,6-tetrafluoroterephthalate 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg.
Dimethyl 2,3,5,6-tetrafluorobenzene-1,4-dicarboxylate (CAS 727-55-9) is a chemical compound with the molecular formula C10H6F4O4 and a molecular weight of 266.15 g/mol. IUPAC name: dimethyl 2,3,5,6-tetrafluorobenzene-1,4-dicarboxylate. InChIKey: JCEMPCVTIITKAC-UHFFFAOYSA-N.
| Molecular formula | C10H6F4O4 |
|---|---|
| Molecular weight | 266.15 g/mol |
| IUPAC name | dimethyl 2,3,5,6-tetrafluorobenzene-1,4-dicarboxylate |
| InChIKey | JCEMPCVTIITKAC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C(=C1F)F)C(=O)OC)F)F |
Computed by PubChem (NCBI)