CAS 786-52-7 is the registry number for 4-Acetoxy-2,3,5,6-tetrafluorobenzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-acetyloxy-2,3,5,6-tetrafluorobenzoate (CAS 786-52-7) is a chemical compound with the molecular formula C10H6F4O4 and a molecular weight of 266.15 g/mol. IUPAC name: methyl 4-acetyloxy-2,3,5,6-tetrafluorobenzoate. InChIKey: HCDXBXJUKUHESO-UHFFFAOYSA-N.
| Molecular formula | C10H6F4O4 |
|---|---|
| Molecular weight | 266.15 g/mol |
| IUPAC name | methyl 4-acetyloxy-2,3,5,6-tetrafluorobenzoate |
| InChIKey | HCDXBXJUKUHESO-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C(=C(C(=C1F)F)C(=O)OC)F)F |
Computed by PubChem (NCBI)