CAS 72700-48-2 appears in our catalog under these names: 4-Chloropteridine, 95+%, 4-Chloropteridine 95+%, 4-Chloropteridine, 95+%, 95+%, 4-Chloropteridine, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g.
4-chloropteridine (CAS 72700-48-2) is a chemical compound with the molecular formula C6H3ClN4 and a molecular weight of 166.57 g/mol. IUPAC name: 4-chloropteridine. InChIKey: RPTAZGNUCCXMMY-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN4 |
|---|---|
| Molecular weight | 166.57 g/mol |
| IUPAC name | 4-chloropteridine |
| InChIKey | RPTAZGNUCCXMMY-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)