CAS 72725-98-5 appears in our catalog under these names: 3-Chloro-2,6-dimethylaniline hydrochloride, 98%, 3-Chloro-2,6-dimethylaniline hydrochloride, 97%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g, 25g.
3-chloro-2,6-dimethylaniline;hydrochloride (CAS 72725-98-5) is a chemical compound with the molecular formula C8H11Cl2N and a molecular weight of 192.08 g/mol. IUPAC name: 3-chloro-2,6-dimethylaniline;hydrochloride. InChIKey: WNBACZJGRRMILU-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N |
|---|---|
| Molecular weight | 192.08 g/mol |
| IUPAC name | 3-chloro-2,6-dimethylaniline;hydrochloride |
| InChIKey | WNBACZJGRRMILU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)C)N.Cl |
Computed by PubChem (NCBI)