Products 72804-83-2
CAS 72804-83-2 is the registry number for 2-Ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine-D3 (cis/trans mixture). Offered by: TRC. Available pack sizes: 50mg.
(2E)-1,5-dimethyl-3,3-diphenyl-2-(2,2,2-trideuterioethylidene)pyrrolidine (CAS 72804-83-2) is a chemical compound with the molecular formula C20H23N and a molecular weight of 280.4 g/mol. IUPAC name: (2E)-1,5-dimethyl-3,3-diphenyl-2-(2,2,2-trideuterioethylidene)pyrrolidine. InChIKey: AJRJPORIQGYFMT-HJQIHABXSA-N.
| Molecular formula | C20H23N |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | (2E)-1,5-dimethyl-3,3-diphenyl-2-(2,2,2-trideuterioethylidene)pyrrolidine |
| InChIKey | AJRJPORIQGYFMT-HJQIHABXSA-N |
| SMILES | [2H]C([2H])([2H])/C=C/1\C(CC(N1C)C)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)