Products 1614218-56-2
CAS 1614218-56-2 is the registry number for (R-(E))-2-Ethylidene-1,5-dimethyl-3,3-diphenyl-pyrrolidine (R-EDDP) Perchlorate. Offered by: TRC. Available pack sizes: 50mg.
(2E,5R)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine (CAS 1614218-56-2) is a chemical compound with the molecular formula C20H23N and a molecular weight of 277.4 g/mol. IUPAC name: (2E,5R)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine. InChIKey: AJRJPORIQGYFMT-FLJZTZRASA-N.
| Molecular formula | C20H23N |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | (2E,5R)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine |
| InChIKey | AJRJPORIQGYFMT-FLJZTZRASA-N |
| SMILES | C/C=C/1\C(C[C@H](N1C)C)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)