Products 106293-57-6
CAS 106293-57-6 appears in our catalog under these names: (S-(E))-2-Ethylidene-1,5-dimethyl-3,3-diphenyl-pyrrolidine (S-EDDP), (S-(E))-2-Ethylidene-1,5-dimethyl-3,3-diphenyl-pyrrolidine (S-EDDP) (1.0 mg/mL in Methanol). Offered by: TRC. Available pack sizes: 100mg, 1x1ml.
(2E,5S)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine (CAS 106293-57-6) is a chemical compound with the molecular formula C20H23N and a molecular weight of 277.4 g/mol. IUPAC name: (2E,5S)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine. InChIKey: AJRJPORIQGYFMT-JVXRWIERSA-N.
| Molecular formula | C20H23N |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | (2E,5S)-2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine |
| InChIKey | AJRJPORIQGYFMT-JVXRWIERSA-N |
| SMILES | C/C=C/1\C(C[C@@H](N1C)C)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)