CAS 7282-94-2 is the registry number for DIMETHYL-D6 DISULFIDE, 98 ATOM % D. Offered by: Sigma-Aldrich. Available pack sizes: 100MG.
Trideuterio-(trideuteriomethyldisulfanyl)methane (CAS 7282-94-2) is a chemical compound with the molecular formula C2H6S2 and a molecular weight of 100.24 g/mol. IUPAC name: trideuterio-(trideuteriomethyldisulfanyl)methane. InChIKey: WQOXQRCZOLPYPM-WFGJKAKNSA-N.
| Molecular formula | C2H6S2 |
|---|---|
| Molecular weight | 100.24 g/mol |
| IUPAC name | trideuterio-(trideuteriomethyldisulfanyl)methane |
| InChIKey | WQOXQRCZOLPYPM-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])SSC([2H])([2H])[2H] |
Computed by PubChem (NCBI)