Products 7284-49-3
CAS 7284-49-3 is the registry number for 1-(Methoxy(methyl)phosphoryl)oxy-4-nitrobenzene. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
1-[methoxy(methyl)phosphoryl]oxy-4-nitrobenzene (CAS 7284-49-3) is a chemical compound with the molecular formula C8H10NO5P and a molecular weight of 231.14 g/mol. IUPAC name: 1-[methoxy(methyl)phosphoryl]oxy-4-nitrobenzene. InChIKey: YLPDBQHTSLQLRX-UHFFFAOYSA-N.
| Molecular formula | C8H10NO5P |
|---|---|
| Molecular weight | 231.14 g/mol |
| IUPAC name | 1-[methoxy(methyl)phosphoryl]oxy-4-nitrobenzene |
| InChIKey | YLPDBQHTSLQLRX-UHFFFAOYSA-N |
| SMILES | COP(=O)(C)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)