CAS 72846-62-9 is the registry number for 2-(4-Isobutyrylphenyl)propane. Offered by: Mikromol. Available pack sizes: 100mg.
2-methyl-1-(4-propan-2-ylphenyl)propan-1-one (CAS 72846-62-9) is a chemical compound with the molecular formula C13H18O and a molecular weight of 190.28 g/mol. IUPAC name: 2-methyl-1-(4-propan-2-ylphenyl)propan-1-one. InChIKey: KJOFMRLNOMBWIM-UHFFFAOYSA-N.
| Molecular formula | C13H18O |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | 2-methyl-1-(4-propan-2-ylphenyl)propan-1-one |
| InChIKey | KJOFMRLNOMBWIM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(=O)C(C)C |
Computed by PubChem (NCBI)