Products 728899-40-9
CAS 728899-40-9 appears in our catalog under these names: {4-(4-(propan-2-yl)benzenesulfonyl)phenyl}hydrazine, 95%, {4-(4-(Propan-2-yl)benzenesulfonyl)phenyl}hydrazine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
[4-(4-propan-2-ylphenyl)sulfonylphenyl]hydrazine (CAS 728899-40-9) is a chemical compound with the molecular formula C15H18N2O2S and a molecular weight of 290.4 g/mol. IUPAC name: [4-(4-propan-2-ylphenyl)sulfonylphenyl]hydrazine. InChIKey: IULNVWCMNWGYSH-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O2S |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | [4-(4-propan-2-ylphenyl)sulfonylphenyl]hydrazine |
| InChIKey | IULNVWCMNWGYSH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)NN |
Computed by PubChem (NCBI)