CAS 729-25-9 is the registry number for L-Threonine beta-naphthylamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
L-threonine 2-naphthylamide is an L-threonine derivative that is the amide obtained by formal condensation of the carboxy group of L-threonine with the amino group of 2-naphthylamine. It has a role as a chromogenic compound. It is an amino acid amide, a L-threonine derivative and a N-(2-naphthyl)carboxamide.
Source: ChEBI
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-hydroxy-N-naphthalen-2-ylbutanamide |
| InChIKey | UJFAUIPJOQKLMK-RNCFNFMXSA-N |
| SMILES | C[C@H]([C@@H](C(=O)NC1=CC2=CC=CC=C2C=C1)N)O |
Computed by PubChem (NCBI)