CAS 729578-90-9 is the registry number for 5-Amino-N-(4-chlorophenyl)-2-methoxybenzene-1-sulfonamide, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
5-amino-N-(4-chlorophenyl)-2-methoxybenzenesulfonamide (CAS 729578-90-9) is a chemical compound with the molecular formula C13H13ClN2O3S and a molecular weight of 312.77 g/mol. IUPAC name: 5-amino-N-(4-chlorophenyl)-2-methoxybenzenesulfonamide. InChIKey: MBEIPMUAHISZTR-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O3S |
|---|---|
| Molecular weight | 312.77 g/mol |
| IUPAC name | 5-amino-N-(4-chlorophenyl)-2-methoxybenzenesulfonamide |
| InChIKey | MBEIPMUAHISZTR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N)S(=O)(=O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)