CAS 91402-37-8 appears in our catalog under these names: 2-Chloro-n-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]acetamide, 95%, 2-Chloro-N-(4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]acetamide (CAS 91402-37-8) is a chemical compound with the molecular formula C13H13ClN2O3S and a molecular weight of 312.77 g/mol. IUPAC name: 2-chloro-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]acetamide. InChIKey: VTOORQMYSUAQLB-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O3S |
|---|---|
| Molecular weight | 312.77 g/mol |
| IUPAC name | 2-chloro-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| InChIKey | VTOORQMYSUAQLB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=CSC(=N2)NC(=O)CCl |
Computed by PubChem (NCBI)