CAS 73029-86-4 appears in our catalog under these names: 2,3-dihydrazinylquinoxaline, 98%, 98%, 2,3-Dihydrazinylquinoxaline, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3-hydrazinylquinoxalin-2-yl)hydrazine (CAS 73029-86-4) is a chemical compound with the molecular formula C8H10N6 and a molecular weight of 190.21 g/mol. IUPAC name: (3-hydrazinylquinoxalin-2-yl)hydrazine. InChIKey: DKEMNWRTZHXCJR-UHFFFAOYSA-N.
| Molecular formula | C8H10N6 |
|---|---|
| Molecular weight | 190.21 g/mol |
| IUPAC name | (3-hydrazinylquinoxalin-2-yl)hydrazine |
| InChIKey | DKEMNWRTZHXCJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(C(=N2)NN)NN |
Computed by PubChem (NCBI)