CAS 958717-43-6 is the registry number for 1-(3-(Pyrazin-2-yl)-1H-1,2,4-triazol-5-yl)ethan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-pyrazin-2-yl-1H-1,2,4-triazol-5-yl)ethanamine (CAS 958717-43-6) is a chemical compound with the molecular formula C8H10N6 and a molecular weight of 190.21 g/mol. IUPAC name: 1-(3-pyrazin-2-yl-1H-1,2,4-triazol-5-yl)ethanamine. InChIKey: VPKKTCYNHHYISW-UHFFFAOYSA-N.
| Molecular formula | C8H10N6 |
|---|---|
| Molecular weight | 190.21 g/mol |
| IUPAC name | 1-(3-pyrazin-2-yl-1H-1,2,4-triazol-5-yl)ethanamine |
| InChIKey | VPKKTCYNHHYISW-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NN1)C2=NC=CN=C2)N |
Computed by PubChem (NCBI)