CAS 730950-31-9 appears in our catalog under these names: (2,6-Dimethyl-phenyl)-(4-p-tolyl-thiazol-2-yl)-amine, 95%, N-(2,6-Dimethylphenyl)-4-(4-methylphenyl)-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
N-(2,6-dimethylphenyl)-4-(4-methylphenyl)-1,3-thiazol-2-amine (CAS 730950-31-9) is a chemical compound with the molecular formula C18H18N2S and a molecular weight of 294.4 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-4-(4-methylphenyl)-1,3-thiazol-2-amine. InChIKey: YYTSQSQEVHDBBY-UHFFFAOYSA-N.
| Molecular formula | C18H18N2S |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-4-(4-methylphenyl)-1,3-thiazol-2-amine |
| InChIKey | YYTSQSQEVHDBBY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=N2)NC3=C(C=CC=C3C)C |
Computed by PubChem (NCBI)