CAS 793678-94-1 is the registry number for 1-(2,4-Dimethylphenyl)-5-(4-methylphenyl)-1h-imidazole-2-thiol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-(2,4-dimethylphenyl)-4-(4-methylphenyl)-1H-imidazole-2-thione (CAS 793678-94-1) is a chemical compound with the molecular formula C18H18N2S and a molecular weight of 294.4 g/mol. IUPAC name: 3-(2,4-dimethylphenyl)-4-(4-methylphenyl)-1H-imidazole-2-thione. InChIKey: HWFDVUZANJFRNO-UHFFFAOYSA-N.
| Molecular formula | C18H18N2S |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | 3-(2,4-dimethylphenyl)-4-(4-methylphenyl)-1H-imidazole-2-thione |
| InChIKey | HWFDVUZANJFRNO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CNC(=S)N2C3=C(C=C(C=C3)C)C |
Computed by PubChem (NCBI)