CAS 730964-72-4 is the registry number for 2-Isocyanosuccinic acid dimethyl ester. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Dimethyl 2-isocyanobutanedioate (CAS 730964-72-4) is a chemical compound with the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. IUPAC name: dimethyl 2-isocyanobutanedioate. InChIKey: ZMXWGHUWPDLSEV-UHFFFAOYSA-N.
| Molecular formula | C7H9NO4 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | dimethyl 2-isocyanobutanedioate |
| InChIKey | ZMXWGHUWPDLSEV-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C(=O)OC)[N+]#[C-] |
Computed by PubChem (NCBI)