CAS 730973-42-9 is the registry number for 4,5,6-Trimethyl-2-sulfanylpyridine-3-carboxamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4,5,6-trimethyl-2-sulfanylidene-1H-pyridine-3-carboxamide (CAS 730973-42-9) is a chemical compound with the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. IUPAC name: 4,5,6-trimethyl-2-sulfanylidene-1H-pyridine-3-carboxamide. InChIKey: NJGPDJBFPDFXNN-UHFFFAOYSA-N.
| Molecular formula | C9H12N2OS |
|---|---|
| Molecular weight | 196.27 g/mol |
| IUPAC name | 4,5,6-trimethyl-2-sulfanylidene-1H-pyridine-3-carboxamide |
| InChIKey | NJGPDJBFPDFXNN-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=S)C(=C1C)C(=O)N)C |
Computed by PubChem (NCBI)