CAS 731003-62-6 is the registry number for 1-(2,6-Difluorobenzenesulfonyl)piperazine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2,6-difluorophenyl)sulfonylpiperazine (CAS 731003-62-6) is a chemical compound with the molecular formula C10H12F2N2O2S and a molecular weight of 262.28 g/mol. IUPAC name: 1-(2,6-difluorophenyl)sulfonylpiperazine. InChIKey: PZSLKDVSXVWFMI-UHFFFAOYSA-N.
| Molecular formula | C10H12F2N2O2S |
|---|---|
| Molecular weight | 262.28 g/mol |
| IUPAC name | 1-(2,6-difluorophenyl)sulfonylpiperazine |
| InChIKey | PZSLKDVSXVWFMI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)