CAS 861225-13-0 is the registry number for 4-Cyclopropyl-6-(difluoromethyl)-2-(ethylsulfonyl)pyrimidine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-cyclopropyl-6-(difluoromethyl)-2-ethylsulfonylpyrimidine (CAS 861225-13-0) is a chemical compound with the molecular formula C10H12F2N2O2S and a molecular weight of 262.28 g/mol. IUPAC name: 4-cyclopropyl-6-(difluoromethyl)-2-ethylsulfonylpyrimidine. InChIKey: ASKZVHVGEJOXMV-UHFFFAOYSA-N.
| Molecular formula | C10H12F2N2O2S |
|---|---|
| Molecular weight | 262.28 g/mol |
| IUPAC name | 4-cyclopropyl-6-(difluoromethyl)-2-ethylsulfonylpyrimidine |
| InChIKey | ASKZVHVGEJOXMV-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=NC(=CC(=N1)C(F)F)C2CC2 |
Computed by PubChem (NCBI)